![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Boris/ | 2007-12-14 21:02 | - | |
| CROPS/ | 2005-09-09 03:10 | - | |
| Credentials_2008/ | 2008-01-11 04:13 | - | |
| FUN.pics/ | 2005-09-09 03:10 | - | |
| Graphics/ | 2006-06-06 18:40 | - | |
| HST/ | 2005-04-09 07:59 | - | |
| ML/ | 2007-07-11 00:34 | - | |
| Music/ | 2007-08-05 09:09 | - | |
| Strangeness.2005/ | 2005-09-16 06:33 | - | |
| The Pentagon Roadmap To Hell_files/ | 2005-08-19 18:00 | - | |
| shrooms/ | 2005-12-12 01:29 | - | |
| wow_whatever/ | 2007-12-10 06:37 | - | |
| 12 Drugs Of Christmas.mp3 | 2005-08-10 22:59 | 3.8M | |
| ABSmokeing.mp3 | 2007-12-11 22:26 | 4.9M | |
| Abalone_roaches.JPG | 2005-07-08 01:16 | 929K | |
| Alien.spyder.jpg | 2005-06-23 06:03 | 300K | |
| Dragonfly.jpg | 2005-06-23 06:09 | 1.0M | |
| From_China_with_LOVE.jpg | 2006-03-23 02:50 | 146K | |
| Is_it_Saturday_yet.MPG | 2005-07-30 20:56 | 3.4M | |
| King.Tut.is.an.alien.jpg | 2005-05-30 05:43 | 99K | |
| ME_GARY_BIGGIES.JPG | 2007-08-12 20:24 | 557K | |
| Mendocino_Madness_leaf.jpg | 2006-07-22 23:25 | 19K | |
| My_GOD.jpg | 2005-09-07 05:07 | 13K | |
| My_Psychedelic_Redwood.jpg | 2005-07-02 20:50 | 209K | |
| My_big.JPG | 2005-07-25 18:07 | 48K | |
| Nike_Logo_stone.jpg | 2006-08-28 21:00 | 73K | |
| Nothing | 2007-07-10 03:00 | 34 | |
| Ollie zoned out.JPG | 2006-06-09 08:09 | 119K | |
| Organic.Pope.jpg | 2005-07-02 20:51 | 78K | |
| Pair_of_Jugs.JPG | 2005-08-10 04:36 | 2.2M | |
| Paradise.Fantasy.jpg | 2005-07-02 20:52 | 152K | |
| Pepperhead.jpg | 2005-06-27 04:57 | 146K | |
| Pirasta.jpg | 2007-08-04 23:24 | 372K | |
| Redwood_tree_male_it_seems.jpg | 2006-08-28 21:00 | 77K | |
| Reggies_ _Ultimate_Fertilizer_Mix.txt | 2005-07-23 19:19 | 1.1K | |
| Serious.Tom.jpg | 2005-07-02 20:53 | 70K | |
| Shochafied.jpg | 2005-07-02 20:54 | 63K | |
| Survival_check_list.html | 2005-09-10 00:23 | 283K | |
| THE_SHOP_PARTY.MPG | 2005-08-21 20:58 | 5.3M | |
| The.Green.Smile.jpg | 2005-06-25 00:58 | 31K | |
| The.Winged.Wonder.jpg | 2005-06-25 00:58 | 121K | |
| The Psychedelic Pope.JPG | 2006-03-17 19:42 | 1.4M | |
| The_Imperial_Thumb_flick.MPG | 2005-10-02 18:19 | 3.9M | |
| Tom_at_the_Psychedelic_Redwood_Tree.jpg | 2005-07-04 03:12 | 168K | |
| Uncle_G.JPG | 2005-06-24 02:03 | 1.0M | |
| Wompers.JPG | 2007-12-11 22:01 | 146K | |
| all_of_us.jpg | 2007-07-11 00:10 | 1.6M | |
| hoopla | 2007-07-10 03:10 | 1.0M | |
| m.c.c.u.shirtlogo.jpg | 2007-07-11 00:07 | 1.4M | |
| ml_and_sister_1.jpg | 2007-07-11 00:06 | 1.6M | |
| ml_and_sister_on_log.jpg | 2007-07-11 00:03 | 1.7M | |
| ml_her_porch.jpg | 2007-07-11 00:00 | 201K | |
| ml_her_porch_two.jpg | 2007-07-11 00:00 | 90K | |
| ml_on_log.jpg | 2007-07-11 00:00 | 1.6M | |
| ml_picture.jpg | 2007-07-10 23:58 | 1.7M | |
| ml_sister.jpg | 2007-07-10 23:55 | 1.6M | |
| ml_trip_001.jpg | 2007-07-10 23:53 | 1.7M | |
| ml_trip_003.jpg | 2007-07-10 23:50 | 1.7M | |
| ml_trip_011.jpg | 2007-07-10 23:48 | 1.6M | |
| ml_trip_drive_thru_redwood.jpg | 2007-07-10 23:45 | 1.9M | |
| press_release__health_canada's_ | 2007-07-10 03:08 | 6.0K | |
| probchld.txt | 2007-07-10 03:08 | 331K | |
| prog-bio.cpu | 2007-07-10 03:08 | 31K | |
| psychedelicshrimp.creole | 2007-07-10 03:08 | 1.3K | |
| radionics.device.manual.pdf | 2007-07-10 03:08 | 27K | |
| re-_kansasfest_2003_and_you! | 2007-07-10 03:08 | 1.8K | |
| re__cooking_with_pot | 2007-07-10 03:08 | 1.7K | |
| re__lsd_as_"mild_stimulant" | 2007-07-10 03:08 | 2.0K | |
| re__wierd_websites | 2007-07-10 03:08 | 2.3K | |
| reggaeon.the.river.jpeg | 2007-07-10 03:08 | 118K | |
| reggaeon.the.river.jpg | 2007-07-10 03:08 | 138K | |
| rum_bubber.ttf | 2007-07-10 03:08 | 15K | |
| sacred_cactus_insights | 2007-07-10 03:08 | 2.1K | |
| salvia_divinorum_in_the_news! | 2007-07-10 03:08 | 4.6K | |
| sassy.txt | 2007-07-10 03:08 | 18K | |
| schizophrenia_spirits | 2007-07-10 03:08 | 5.0K | |
| selegiline.structure.pdf | 2007-07-10 03:08 | 78K | |
| sept._13,_2003_cultivation_link | 2007-07-10 03:07 | 6.2K | |
| shamanic_art.names.of.god | 2007-07-10 03:07 | 6.2K | |
| sinapse.txt | 2007-07-10 03:07 | 2.2K | |
| speaking_of_nutrients | 2007-07-10 03:07 | 556 | |
| the_beaming_of_intelligence | 2007-07-10 03:07 | 18K | |
| the_enemy_is_us_2015.txt | 2007-07-10 03:07 | 5.4K | |
| the_truth.pdf | 2007-07-10 03:07 | 1.0M | |
| the_ultimate_experience.mp3 | 2007-07-10 03:06 | 4.4M | |
| thumbs.db | 2007-07-10 23:40 | 124K | |
| tom.house.8.2003.jpeg | 2007-07-10 03:00 | 54K | |
| tom_&_julia.jpg | 2007-07-10 23:39 | 42K | |
| toms_rose.jpg | 2007-07-10 23:39 | 2.0M | |
| toms_rose_two.jpg | 2007-07-10 23:37 | 2.0M | |
| usa.churchola.mid | 2007-07-10 03:00 | 24K | |
| vendors.for.2ci | 2010-07-29 19:33 | 2.4K | |
| what.u.got.jpeg | 2007-07-10 03:00 | 86K | |
| woodenships.ja.1975.txt | 2007-07-10 02:59 | 1.9K | |
| xtra_potency_achieved_easily | 2007-07-10 02:59 | 259 | |